N-Doped Carbon Nanofibers Encapsulating CoO@Co9S8 Nanoparticles: Preparation from S-Rich Co32 Coordination Cluster Precursors by Electrospinning and Application for Superior Li-ion Storage
Siran Yang , Feixue Ai , Ziping Li , Guiyan Zhao , Yanfeng Bi
Chemical Research in Chinese Universities ›› 2022, Vol. 38 ›› Issue (2) : 603 -608.
N-Doped Carbon Nanofibers Encapsulating CoO@Co9S8 Nanoparticles: Preparation from S-Rich Co32 Coordination Cluster Precursors by Electrospinning and Application for Superior Li-ion Storage
Thiacalixarene-supported Co32 nanoclusters encapsulated in polyacrylonitrile nanofibers(Co32@PAN-NFs) by electrospinning have been utilized as precursors to fabricate N-doped CoO@Co9S8 carbon nanofibers(CoO@Co9S8@CNFs) for superior Li-ion storage. The S-rich Co32 clusters capped by organic sheets afforded the well dispersed cobalt oxide/sulfide nanoparticles embedded in carbon nanofiber composites by direct calcination. The N-doped CoO@Co9S8@CNFs nanocomposites have been utilized as anode materials for lithium ion battery with the reversible capabilities being of 1051.8, 967.6, 894.7, 782.7, 669.5 and 525.4 mA·h/g at 0.1, 0.2, 0.5, 1, 2 and 3 A/g, respectively. The CoO@Co9S8@CNFs also showed a relatively high stable capacity of 551.7 mA·h/g at the current density of 1 A/g after 200 cycles of rate experiments. The as-obtained N-doped CoO@Co9S8@CNFs nanocomposites exhibited superior reversible capacity, rate performance, Coulomb efficiency(74.5% vs. 63.9%) and cyclic stability comparing with the CoO@Co9S8@C derived from simple annealing of Co32 templates.
Metal cluster precursor / Carbon nanofiber / Electrospinning / Li-ion storage
| [1] |
|
| [2] |
|
| [3] |
|
| [4] |
|
| [5] |
|
| [6] |
|
| [7] |
|
| [8] |
|
| [9] |
|
| [10] |
|
| [11] |
|
| [12] |
|
| [13] |
|
| [14] |
|
| [15] |
|
| [16] |
|
| [17] |
|
| [18] |
|
| [19] |
|
| [20] |
|
| [21] |
|
| [22] |
|
| [23] |
|
| [24] |
|
| [25] |
|
| [26] |
|
| [27] |
|
| [28] |
|
| [29] |
|
| [30] |
|
| [31] |
|
| [32] |
|
| [33] |
|
| [34] |
|
| [35] |
|
| [36] |
|
| [37] |
|
| [38] |
|
| [39] |
|
| [40] |
|
| [41] |
|
/
| 〈 |
|
〉 |